| Molecular Weight | 516.6 |
|---|---|
| Formula | C29H35F3N2O3 |
| CAS No. | 1230487-00-9 |
| Storage | powder in solvent |
| Synonyms | N/A |
| Smiles | CCC1=C(C=CC(=C1)C(=NOCC2=CC(=C(C=C2)C3CCCCC3)C(F)(F)F)C)CN4CC(C4)C(=O)O |
BAF312 CAS 1230487-00-9 Siponimod
$1,400.00
BAF312 (Siponimod) is a next-generation S1P receptor agonist, selective for S1P1 and S1P5 receptors with EC50 of 0.39 nM and 0.98 nM, exhibits >1000-fold selectivity over S1P2, S1P3 and S1P4 receptors.
| Weight | 1 g |
|---|
