| Molecular Weight | 443.31 |
|---|---|
| Formula | C17H11F6N7O |
| CAS No. | 1393477-72-9 |
| Storage | powder in solvent |
| Synonyms | ATG-010 |
| Smiles | C1=CN=C(C=N1)NNC(=O)C=CN2C=NC(=N2)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| As the clinical candidate analog of KPT-185, KPT-330 exhibits similar effects on the viability of T-ALL cells and elicits rapid apoptotic response. KPT-330 also reduces cell growth in MOLT-4, Jurkat, HBP-ALL, KOPTK-1, SKW-3, and DND-41 cell lines, with IC50 values of 34-203 nM |
