| Molecular Weight | 314.30 |
|---|---|
| Formula | C13H14N8O2 |
| CAS No. | 1154028-82-6 |
| Storage | powder in solvent |
| Synonyms | N/A |
| Smiles | C1COCCN1C2=NC=NC(=C2)N3C(=O)C(=CN3)N4C=CN=N4 |
Bay85-3934 99% powder CAS 1154028-82-6 Molidustat
$245.00
Molidustat (BAY 85-3934) is a potent hypoxia-inducible factor prolyl hydroxylase (HIF-PH) inhibitor with IC50 of 480 nM, 280 nM, and 450 nM for PHD1, PHD2, and PHD, respectively. Phase 2.




